(3S)-1,1-dioxothiane-3-carboxylic acid

C6H10O4S — CID 10419743

IUPAC(3S)-1,1-dioxothiane-3-carboxylic acid
SMILESO=C(O)[C@@H]1CCCS(=O)(=O)C1
InChIInChI=1S/C6H10O4S/c7-6(8)5-2-1-3-11(9,10)4-5/h5H,1-4H2,(H,7,8)/t5-/m1/s1
InChIKeyUGIYZUNKFKCETD-RXMQYKEDSA-N
MW178.21 g/mol
LogP-0.10
Rot. Bonds1

About (3S)-1,1-dioxothiane-3-carboxylic acid

(3S)-1,1-dioxothiane-3-carboxylic acid (PubChem CID 10419743) has the molecular formula C6H10O4S and a molecular weight of 178.21 g/mol. Its IUPAC name is (3S)-1,1-dioxothiane-3-carboxylic acid.

Molecular Properties

Compound Name(3S)-1,1-dioxothiane-3-carboxylic acid
PubChem CID10419743
Molecular FormulaC6H10O4S
Molecular Weight178.21 g/mol
Exact Mass178.03
IUPAC Name(3S)-1,1-dioxothiane-3-carboxylic acid
SMILESO=C(O)[C@@H]1CCCS(=O)(=O)C1
InChIInChI=1S/C6H10O4S/c7-6(8)5-2-1-3-11(9,10)4-5/h5H,1-4H2,(H,7,8)/t5-/m1/s1
InChIKeyUGIYZUNKFKCETD-RXMQYKEDSA-N
XLogP-0.10
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.21
LogP ≤ 5-0.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3S)-1,1-dioxothiane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-1,1-dioxothiane-3-carboxylic acid?
The IUPAC name of (3S)-1,1-dioxothiane-3-carboxylic acid (CID 10419743) is (3S)-1,1-dioxothiane-3-carboxylic acid.
What is the SMILES notation for (3S)-1,1-dioxothiane-3-carboxylic acid?
The canonical SMILES for (3S)-1,1-dioxothiane-3-carboxylic acid is O=C(O)[C@@H]1CCCS(=O)(=O)C1.
What is the InChIKey of (3S)-1,1-dioxothiane-3-carboxylic acid?
The InChIKey is UGIYZUNKFKCETD-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10O4S/c7-6(8)5-2-1-3-11(9,10)4-5/h5H,1-4H2,(H,7,8)/t5-/m1/s1.
What are the key properties of (3S)-1,1-dioxothiane-3-carboxylic acid?
(3S)-1,1-dioxothiane-3-carboxylic acid has a molecular weight of 178.21 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,1-dioxothiane-3-carboxylic acid is sourced from PubChem (CID 10419743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).