About 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one
4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one (PubChem CID 10419760) has the molecular formula C9H9NO3
and a molecular weight of 179.18 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one |
| PubChem CID | 10419760 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one |
| SMILES | O=C1OCC(CO)=C2C=CC=CN12 |
| InChI | InChI=1S/C9H9NO3/c11-5-7-6-13-9(12)10-4-2-1-3-8(7)10/h1-4,11H,5-6H2 |
| InChIKey | SMHINLKTUPBGIG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one?
The IUPAC name of 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one (CID 10419760) is 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one.
What is the SMILES notation for 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one?
The canonical SMILES for 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one is O=C1OCC(CO)=C2C=CC=CN12.
What is the InChIKey of 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one?
The InChIKey is SMHINLKTUPBGIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c11-5-7-6-13-9(12)10-4-2-1-3-8(7)10/h1-4,11H,5-6H2.
What are the key properties of 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one?
4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one has a molecular weight of 179.18 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-3H-pyrido[1,2-c][1,3]oxazin-1-one is sourced from PubChem (CID 10419760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).