methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate

C9H12N2O2 — CID 10419778

IUPACmethyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate
SMILESCOC(=O)N1CC(C#N)=CCC1C
InChIInChI=1S/C9H12N2O2/c1-7-3-4-8(5-10)6-11(7)9(12)13-2/h4,7H,3,6H2,1-2H3
InChIKeySHGDNRZZRZLVOR-UHFFFAOYSA-N
MW180.21 g/mol
LogP1.30
Rot. Bonds

About methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate

methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 10419778) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.

Molecular Properties

Compound Namemethyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate
PubChem CID10419778
Molecular FormulaC9H12N2O2
Molecular Weight180.21 g/mol
Exact Mass180.09
IUPAC Namemethyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate
SMILESCOC(=O)N1CC(C#N)=CCC1C
InChIInChI=1S/C9H12N2O2/c1-7-3-4-8(5-10)6-11(7)9(12)13-2/h4,7H,3,6H2,1-2H3
InChIKeySHGDNRZZRZLVOR-UHFFFAOYSA-N
XLogP1.30
TPSA53.33 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.21
LogP ≤ 51.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 10419778) is methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate is COC(=O)N1CC(C#N)=CCC1C.
What is the InChIKey of methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is SHGDNRZZRZLVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-7-3-4-8(5-10)6-11(7)9(12)13-2/h4,7H,3,6H2,1-2H3.
What are the key properties of methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate?
methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 180.21 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-cyano-2-methyl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 10419778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).