About 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal
2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal (PubChem CID 10419813) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal.
Molecular Properties
| Compound Name | 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal |
| PubChem CID | 10419813 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal |
| SMILES | COc1c(C(C)(C)C=O)c(=O)c1=O |
| InChI | InChI=1S/C9H10O4/c1-9(2,4-10)5-6(11)7(12)8(5)13-3/h4H,1-3H3 |
| InChIKey | ZRXICSLFAJDYFF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal?
The IUPAC name of 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal (CID 10419813) is 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal.
What is the SMILES notation for 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal?
The canonical SMILES for 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal is COc1c(C(C)(C)C=O)c(=O)c1=O.
What is the InChIKey of 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal?
The InChIKey is ZRXICSLFAJDYFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-9(2,4-10)5-6(11)7(12)8(5)13-3/h4H,1-3H3.
What are the key properties of 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal?
2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal has a molecular weight of 182.17 g/mol, XLogP of -0.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxy-3,4-dioxocyclobuten-1-yl)-2-methylpropanal is sourced from PubChem (CID 10419813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).