About 2-sulfonyl-1,3-dihydrobenzimidazole
2-sulfonyl-1,3-dihydrobenzimidazole (PubChem CID 10419816) has the molecular formula C7H6N2O2S
and a molecular weight of 182.20 g/mol. Its IUPAC name is 2-sulfonyl-1,3-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 2-sulfonyl-1,3-dihydrobenzimidazole |
| PubChem CID | 10419816 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 2-sulfonyl-1,3-dihydrobenzimidazole |
| SMILES | O=S(=O)=c1[nH]c2ccccc2[nH]1 |
| InChI | InChI=1S/C7H6N2O2S/c10-12(11)7-8-5-3-1-2-4-6(5)9-7/h1-4,8-9H |
| InChIKey | VNQSJROWHKEIMD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfonyl-1,3-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfonyl-1,3-dihydrobenzimidazole?
The IUPAC name of 2-sulfonyl-1,3-dihydrobenzimidazole (CID 10419816) is 2-sulfonyl-1,3-dihydrobenzimidazole.
What is the SMILES notation for 2-sulfonyl-1,3-dihydrobenzimidazole?
The canonical SMILES for 2-sulfonyl-1,3-dihydrobenzimidazole is O=S(=O)=c1[nH]c2ccccc2[nH]1.
What is the InChIKey of 2-sulfonyl-1,3-dihydrobenzimidazole?
The InChIKey is VNQSJROWHKEIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2S/c10-12(11)7-8-5-3-1-2-4-6(5)9-7/h1-4,8-9H.
What are the key properties of 2-sulfonyl-1,3-dihydrobenzimidazole?
2-sulfonyl-1,3-dihydrobenzimidazole has a molecular weight of 182.20 g/mol, XLogP of 0.91, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfonyl-1,3-dihydrobenzimidazole is sourced from PubChem (CID 10419816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).