About ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate
ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate (PubChem CID 10419889) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate |
| PubChem CID | 10419889 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate |
| SMILES | CCOC(=O)c1noc(CCN)n1 |
| InChI | InChI=1S/C7H11N3O3/c1-2-12-7(11)6-9-5(3-4-8)13-10-6/h2-4,8H2,1H3 |
| InChIKey | PFCATDAIDKUEFO-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate?
The IUPAC name of ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate (CID 10419889) is ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate?
The canonical SMILES for ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate is CCOC(=O)c1noc(CCN)n1.
What is the InChIKey of ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate?
The InChIKey is PFCATDAIDKUEFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c1-2-12-7(11)6-9-5(3-4-8)13-10-6/h2-4,8H2,1H3.
What are the key properties of ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate?
ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate has a molecular weight of 185.18 g/mol, XLogP of -0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2-aminoethyl)-1,2,4-oxadiazole-3-carboxylate is sourced from PubChem (CID 10419889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).