C13H21N — CID 10420084
5-tert-butyl-2,3,4,5,6,7-hexahydroinden-1-imine (PubChem CID 10420084) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 5-tert-butyl-2,3,4,5,6,7-hexahydroinden-1-imine.
| Compound Name | 5-tert-butyl-2,3,4,5,6,7-hexahydroinden-1-imine |
|---|---|
| PubChem CID | 10420084 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 5-tert-butyl-2,3,4,5,6,7-hexahydroinden-1-imine |
| SMILES | [H]/N=C1\CCC2=C1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C13H21N/c1-13(2,3)10-5-6-11-9(8-10)4-7-12(11)14/h10,14H,4-8H2,1-3H3/b14-12+ |
| InChIKey | VIWWEWNVVVZOMQ-WYMLVPIESA-N |
| XLogP | 3.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|