About 4-bromo-1,1-dimethoxybutane
4-bromo-1,1-dimethoxybutane (PubChem CID 10420225) has the molecular formula C6H13BrO2
and a molecular weight of 197.07 g/mol. Its IUPAC name is 4-bromo-1,1-dimethoxybutane.
Molecular Properties
| Compound Name | 4-bromo-1,1-dimethoxybutane |
| PubChem CID | 10420225 |
| Molecular Formula | C6H13BrO2 |
| Molecular Weight | 197.07 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 4-bromo-1,1-dimethoxybutane |
| SMILES | COC(CCCBr)OC |
| InChI | InChI=1S/C6H13BrO2/c1-8-6(9-2)4-3-5-7/h6H,3-5H2,1-2H3 |
| InChIKey | QPNPLSCMVPQSEZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.07 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,1-dimethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,1-dimethoxybutane?
The IUPAC name of 4-bromo-1,1-dimethoxybutane (CID 10420225) is 4-bromo-1,1-dimethoxybutane.
What is the SMILES notation for 4-bromo-1,1-dimethoxybutane?
The canonical SMILES for 4-bromo-1,1-dimethoxybutane is COC(CCCBr)OC.
What is the InChIKey of 4-bromo-1,1-dimethoxybutane?
The InChIKey is QPNPLSCMVPQSEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13BrO2/c1-8-6(9-2)4-3-5-7/h6H,3-5H2,1-2H3.
What are the key properties of 4-bromo-1,1-dimethoxybutane?
4-bromo-1,1-dimethoxybutane has a molecular weight of 197.07 g/mol, XLogP of 1.78, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,1-dimethoxybutane is sourced from PubChem (CID 10420225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).