About (3-cyanophenyl) sulfamate
(3-cyanophenyl) sulfamate (PubChem CID 10420257) has the molecular formula C7H6N2O3S
and a molecular weight of 198.20 g/mol. Its IUPAC name is (3-cyanophenyl) sulfamate.
Molecular Properties
| Compound Name | (3-cyanophenyl) sulfamate |
| PubChem CID | 10420257 |
| Molecular Formula | C7H6N2O3S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | (3-cyanophenyl) sulfamate |
| SMILES | N#Cc1cccc(OS(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H6N2O3S/c8-5-6-2-1-3-7(4-6)12-13(9,10)11/h1-4H,(H2,9,10,11) |
| InChIKey | LJMMVSSXNQNZJW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-cyanophenyl) sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyanophenyl) sulfamate?
The IUPAC name of (3-cyanophenyl) sulfamate (CID 10420257) is (3-cyanophenyl) sulfamate.
What is the SMILES notation for (3-cyanophenyl) sulfamate?
The canonical SMILES for (3-cyanophenyl) sulfamate is N#Cc1cccc(OS(N)(=O)=O)c1.
What is the InChIKey of (3-cyanophenyl) sulfamate?
The InChIKey is LJMMVSSXNQNZJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3S/c8-5-6-2-1-3-7(4-6)12-13(9,10)11/h1-4H,(H2,9,10,11).
What are the key properties of (3-cyanophenyl) sulfamate?
(3-cyanophenyl) sulfamate has a molecular weight of 198.20 g/mol, XLogP of 0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyanophenyl) sulfamate is sourced from PubChem (CID 10420257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).