About 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde
2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde (PubChem CID 10420317) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde |
| PubChem CID | 10420317 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde |
| SMILES | C=CC1(COCC=O)COC(C)(C)O1 |
| InChI | InChI=1S/C10H16O4/c1-4-10(7-12-6-5-11)8-13-9(2,3)14-10/h4-5H,1,6-8H2,2-3H3 |
| InChIKey | MQBQPWIFDPNNRR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde?
The IUPAC name of 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde (CID 10420317) is 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde.
What is the SMILES notation for 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde?
The canonical SMILES for 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde is C=CC1(COCC=O)COC(C)(C)O1.
What is the InChIKey of 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde?
The InChIKey is MQBQPWIFDPNNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-4-10(7-12-6-5-11)8-13-9(2,3)14-10/h4-5H,1,6-8H2,2-3H3.
What are the key properties of 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde?
2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde has a molecular weight of 200.23 g/mol, XLogP of 0.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]acetaldehyde is sourced from PubChem (CID 10420317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).