About N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide
N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide (PubChem CID 10420355) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide |
| PubChem CID | 10420355 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCC(OC)OC |
| InChI | InChI=1S/C10H19NO3/c1-8(2)10(12)11-7-5-6-9(13-3)14-4/h9H,1,5-7H2,2-4H3,(H,11,12) |
| InChIKey | CNIIWDYLLMUOAJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide?
The IUPAC name of N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide (CID 10420355) is N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide.
What is the SMILES notation for N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide?
The canonical SMILES for N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide is C=C(C)C(=O)NCCCC(OC)OC.
What is the InChIKey of N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide?
The InChIKey is CNIIWDYLLMUOAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-8(2)10(12)11-7-5-6-9(13-3)14-4/h9H,1,5-7H2,2-4H3,(H,11,12).
What are the key properties of N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide?
N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide has a molecular weight of 201.27 g/mol, XLogP of 1.08, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethoxybutyl)-2-methylprop-2-enamide is sourced from PubChem (CID 10420355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).