C13H16O2 — CID 10420451
(1'R,2'S,6'R,7'S)-2'-methylspiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene] (PubChem CID 10420451) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (1'R,2'S,6'R,7'S)-2'-methylspiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene].
| Compound Name | (1'R,2'S,6'R,7'S)-2'-methylspiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene] |
|---|---|
| PubChem CID | 10420451 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (1'R,2'S,6'R,7'S)-2'-methylspiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene] |
| SMILES | C[C@@]12C=CC3(OCCO3)[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C13H16O2/c1-12-4-5-13(14-6-7-15-13)11(12)9-2-3-10(12)8-9/h2-5,9-11H,6-8H2,1H3/t9-,10+,11-,12+/m1/s1 |
| InChIKey | FMAFUAKOJLGQQX-KXNHARMFSA-N |
| XLogP | 2.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|