About 3-pyrazol-1-ylnonan-2-ol
3-pyrazol-1-ylnonan-2-ol (PubChem CID 10420657) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-pyrazol-1-ylnonan-2-ol.
Molecular Properties
| Compound Name | 3-pyrazol-1-ylnonan-2-ol |
| PubChem CID | 10420657 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3-pyrazol-1-ylnonan-2-ol |
| SMILES | CCCCCCC(C(C)O)n1cccn1 |
| InChI | InChI=1S/C12H22N2O/c1-3-4-5-6-8-12(11(2)15)14-10-7-9-13-14/h7,9-12,15H,3-6,8H2,1-2H3 |
| InChIKey | IJCXQZWAZPGFQK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrazol-1-ylnonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazol-1-ylnonan-2-ol?
The IUPAC name of 3-pyrazol-1-ylnonan-2-ol (CID 10420657) is 3-pyrazol-1-ylnonan-2-ol.
What is the SMILES notation for 3-pyrazol-1-ylnonan-2-ol?
The canonical SMILES for 3-pyrazol-1-ylnonan-2-ol is CCCCCCC(C(C)O)n1cccn1.
What is the InChIKey of 3-pyrazol-1-ylnonan-2-ol?
The InChIKey is IJCXQZWAZPGFQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-3-4-5-6-8-12(11(2)15)14-10-7-9-13-14/h7,9-12,15H,3-6,8H2,1-2H3.
What are the key properties of 3-pyrazol-1-ylnonan-2-ol?
3-pyrazol-1-ylnonan-2-ol has a molecular weight of 210.32 g/mol, XLogP of 2.78, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazol-1-ylnonan-2-ol is sourced from PubChem (CID 10420657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).