C15H18O — CID 10420799
[(1S,2R)-2-prop-1-ynoxycyclohexyl]benzene (PubChem CID 10420799) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is [(1S,2R)-2-prop-1-ynoxycyclohexyl]benzene.
| Compound Name | [(1S,2R)-2-prop-1-ynoxycyclohexyl]benzene |
|---|---|
| PubChem CID | 10420799 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | [(1S,2R)-2-prop-1-ynoxycyclohexyl]benzene |
| SMILES | CC#CO[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H18O/c1-2-12-16-15-11-7-6-10-14(15)13-8-4-3-5-9-13/h3-5,8-9,14-15H,6-7,10-11H2,1H3/t14-,15+/m0/s1 |
| InChIKey | TXSCKBQWSFUOOJ-LSDHHAIUSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|