C24H27BrO5 — CID 1042105
9-(2-bromo-4-hydroxy-5-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 1042105) has the molecular formula C24H27BrO5 and a molecular weight of 475.38 g/mol. Its IUPAC name is 9-(2-bromo-4-hydroxy-5-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(2-bromo-4-hydroxy-5-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1042105 |
| Molecular Formula | C24H27BrO5 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 9-(2-bromo-4-hydroxy-5-methoxyphenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)c(Br)cc1O |
| InChI | InChI=1S/C24H27BrO5/c1-23(2)8-15(27)21-18(10-23)30-19-11-24(3,4)9-16(28)22(19)20(21)12-6-17(29-5)14(26)7-13(12)25/h6-7,20,26H,8-11H2,1-5H3 |
| InChIKey | CFMDYAQILNGYAK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |