C13H18O3 — CID 10421093
ethyl (1R,3aR,6aR)-6a-ethynyl-1-hydroxy-1,2,3,4,5,6-hexahydropentalene-3a-carboxylate (PubChem CID 10421093) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is ethyl (1R,3aR,6aR)-6a-ethynyl-1-hydroxy-1,2,3,4,5,6-hexahydropentalene-3a-carboxylate.
| Compound Name | ethyl (1R,3aR,6aR)-6a-ethynyl-1-hydroxy-1,2,3,4,5,6-hexahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 10421093 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | ethyl (1R,3aR,6aR)-6a-ethynyl-1-hydroxy-1,2,3,4,5,6-hexahydropentalene-3a-carboxylate |
| SMILES | C#C[C@]12CCC[C@@]1(C(=O)OCC)CC[C@H]2O |
| InChI | InChI=1S/C13H18O3/c1-3-12-7-5-8-13(12,9-6-10(12)14)11(15)16-4-2/h1,10,14H,4-9H2,2H3/t10-,12-,13+/m1/s1 |
| InChIKey | IFFDAXPPYRXSCU-RTXFEEFZSA-N |
| XLogP | 1.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|