C13H20O3 — CID 10421184
(1R,6S,8R,9S,11S)-2,6-dimethyl-12-oxatricyclo[6.3.1.01,6]dodec-2-ene-9,11-diol (PubChem CID 10421184) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (1R,6S,8R,9S,11S)-2,6-dimethyl-12-oxatricyclo[6.3.1.01,6]dodec-2-ene-9,11-diol.
| Compound Name | (1R,6S,8R,9S,11S)-2,6-dimethyl-12-oxatricyclo[6.3.1.01,6]dodec-2-ene-9,11-diol |
|---|---|
| PubChem CID | 10421184 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1R,6S,8R,9S,11S)-2,6-dimethyl-12-oxatricyclo[6.3.1.01,6]dodec-2-ene-9,11-diol |
| SMILES | CC1=CCC[C@@]2(C)C[C@H]3O[C@@]12[C@@H](O)C[C@@H]3O |
| InChI | InChI=1S/C13H20O3/c1-8-4-3-5-12(2)7-10-9(14)6-11(15)13(8,12)16-10/h4,9-11,14-15H,3,5-7H2,1-2H3/t9-,10+,11-,12-,13+/m0/s1 |
| InChIKey | DGBKUYUKIJRIJS-FPYNETTCSA-N |
| XLogP | 1.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|