C14H12OS — CID 10421315
3,3-dimethylbenzo[f][2]benzofuran-1-thione (PubChem CID 10421315) has the molecular formula C14H12OS and a molecular weight of 228.32 g/mol. Its IUPAC name is 3,3-dimethylbenzo[f][2]benzofuran-1-thione.
| Compound Name | 3,3-dimethylbenzo[f][2]benzofuran-1-thione |
|---|---|
| PubChem CID | 10421315 |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3,3-dimethylbenzo[f][2]benzofuran-1-thione |
| SMILES | CC1(C)OC(=S)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C14H12OS/c1-14(2)12-8-10-6-4-3-5-9(10)7-11(12)13(16)15-14/h3-8H,1-2H3 |
| InChIKey | DMTKZDZSRZHXPV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|