C15H26Si — CID 10421557
trimethyl-[2-[(1S,2S)-2-[(Z)-pent-2-enyl]cyclopentyl]ethynyl]silane (PubChem CID 10421557) has the molecular formula C15H26Si and a molecular weight of 234.46 g/mol. Its IUPAC name is trimethyl-[2-[(1S,2S)-2-[(Z)-pent-2-enyl]cyclopentyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(1S,2S)-2-[(Z)-pent-2-enyl]cyclopentyl]ethynyl]silane |
|---|---|
| PubChem CID | 10421557 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | trimethyl-[2-[(1S,2S)-2-[(Z)-pent-2-enyl]cyclopentyl]ethynyl]silane |
| SMILES | CC/C=C\C[C@@H]1CCC[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H26Si/c1-5-6-7-9-14-10-8-11-15(14)12-13-16(2,3)4/h6-7,14-15H,5,8-11H2,1-4H3/b7-6-/t14-,15-/m1/s1 |
| InChIKey | CQDYEZIBOYSPLI-YOVCOIKASA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|