C13H12N2O3 — CID 10421909
7,8-dimethoxy-2,5-dihydroindeno[1,2-c]pyridazin-3-one (PubChem CID 10421909) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 7,8-dimethoxy-2,5-dihydroindeno[1,2-c]pyridazin-3-one.
| Compound Name | 7,8-dimethoxy-2,5-dihydroindeno[1,2-c]pyridazin-3-one |
|---|---|
| PubChem CID | 10421909 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 7,8-dimethoxy-2,5-dihydroindeno[1,2-c]pyridazin-3-one |
| SMILES | COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 |
| InChI | InChI=1S/C13H12N2O3/c1-17-10-4-7-3-8-5-12(16)14-15-13(8)9(7)6-11(10)18-2/h4-6H,3H2,1-2H3,(H,14,16) |
| InChIKey | OMMMFPPVKIEEKW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |