About 8-hexoxyquinolin-2-amine
8-hexoxyquinolin-2-amine (PubChem CID 10421932) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is 8-hexoxyquinolin-2-amine.
Molecular Properties
| Compound Name | 8-hexoxyquinolin-2-amine |
| PubChem CID | 10421932 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 8-hexoxyquinolin-2-amine |
| SMILES | CCCCCCOc1cccc2ccc(N)nc12 |
| InChI | InChI=1S/C15H20N2O/c1-2-3-4-5-11-18-13-8-6-7-12-9-10-14(16)17-15(12)13/h6-10H,2-5,11H2,1H3,(H2,16,17) |
| InChIKey | SBZZEIZRHJBKKE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-hexoxyquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hexoxyquinolin-2-amine?
The IUPAC name of 8-hexoxyquinolin-2-amine (CID 10421932) is 8-hexoxyquinolin-2-amine.
What is the SMILES notation for 8-hexoxyquinolin-2-amine?
The canonical SMILES for 8-hexoxyquinolin-2-amine is CCCCCCOc1cccc2ccc(N)nc12.
What is the InChIKey of 8-hexoxyquinolin-2-amine?
The InChIKey is SBZZEIZRHJBKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O/c1-2-3-4-5-11-18-13-8-6-7-12-9-10-14(16)17-15(12)13/h6-10H,2-5,11H2,1H3,(H2,16,17).
What are the key properties of 8-hexoxyquinolin-2-amine?
8-hexoxyquinolin-2-amine has a molecular weight of 244.34 g/mol, XLogP of 3.78, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hexoxyquinolin-2-amine is sourced from PubChem (CID 10421932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).