About 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine
2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine (PubChem CID 10421947) has the molecular formula C11H14Cl2N2
and a molecular weight of 245.15 g/mol. Its IUPAC name is 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine.
Molecular Properties
| Compound Name | 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine |
| PubChem CID | 10421947 |
| Molecular Formula | C11H14Cl2N2 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine |
| SMILES | NCC1(N)CCc2cc(Cl)c(Cl)cc2C1 |
| InChI | InChI=1S/C11H14Cl2N2/c12-9-3-7-1-2-11(15,6-14)5-8(7)4-10(9)13/h3-4H,1-2,5-6,14-15H2 |
| InChIKey | XKLHIJJSVVXEPZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine?
The IUPAC name of 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine (CID 10421947) is 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine.
What is the SMILES notation for 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine?
The canonical SMILES for 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine is NCC1(N)CCc2cc(Cl)c(Cl)cc2C1.
What is the InChIKey of 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine?
The InChIKey is XKLHIJJSVVXEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14Cl2N2/c12-9-3-7-1-2-11(15,6-14)5-8(7)4-10(9)13/h3-4H,1-2,5-6,14-15H2.
What are the key properties of 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine?
2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine has a molecular weight of 245.15 g/mol, XLogP of 2.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-6,7-dichloro-3,4-dihydro-1H-naphthalen-2-amine is sourced from PubChem (CID 10421947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).