C15H19NO2 — CID 10421983
(6R,8aS)-6-phenylmethoxy-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-one (PubChem CID 10421983) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (6R,8aS)-6-phenylmethoxy-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-one.
| Compound Name | (6R,8aS)-6-phenylmethoxy-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-one |
|---|---|
| PubChem CID | 10421983 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (6R,8aS)-6-phenylmethoxy-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-one |
| SMILES | O=C1CCN2C[C@H](OCc3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C15H19NO2/c17-15-8-9-16-10-13(6-7-14(15)16)18-11-12-4-2-1-3-5-12/h1-5,13-14H,6-11H2/t13-,14+/m1/s1 |
| InChIKey | WSGPXPGNOUDPPZ-KGLIPLIRSA-N |
| XLogP | 2.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |