About 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione
1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione (PubChem CID 10422086) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione.
Molecular Properties
| Compound Name | 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione |
| PubChem CID | 10422086 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione |
| SMILES | CCCCCCn1c2c(ccc1=O)C(=O)CCC2 |
| InChI | InChI=1S/C15H21NO2/c1-2-3-4-5-11-16-13-7-6-8-14(17)12(13)9-10-15(16)18/h9-10H,2-8,11H2,1H3 |
| InChIKey | XUPWYKMMPHMUEZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione?
The IUPAC name of 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione (CID 10422086) is 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione.
What is the SMILES notation for 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione?
The canonical SMILES for 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione is CCCCCCn1c2c(ccc1=O)C(=O)CCC2.
What is the InChIKey of 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione?
The InChIKey is XUPWYKMMPHMUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-2-3-4-5-11-16-13-7-6-8-14(17)12(13)9-10-15(16)18/h9-10H,2-8,11H2,1H3.
What are the key properties of 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione?
1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione has a molecular weight of 247.34 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-7,8-dihydro-6H-quinoline-2,5-dione is sourced from PubChem (CID 10422086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).