About indeno[2,1-b]chromene-6,11-dione
indeno[2,1-b]chromene-6,11-dione (PubChem CID 10422105) has the molecular formula C16H8O3
and a molecular weight of 248.24 g/mol. Its IUPAC name is indeno[2,1-b]chromene-6,11-dione.
Molecular Properties
| Compound Name | indeno[2,1-b]chromene-6,11-dione |
| PubChem CID | 10422105 |
| Molecular Formula | C16H8O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | indeno[2,1-b]chromene-6,11-dione |
| SMILES | O=C1c2ccccc2-c2c1oc1ccccc1c2=O |
| InChI | InChI=1S/C16H8O3/c17-14-11-7-3-4-8-12(11)19-16-13(14)9-5-1-2-6-10(9)15(16)18/h1-8H |
| InChIKey | CXXCRLLJRGEAJV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze indeno[2,1-b]chromene-6,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indeno[2,1-b]chromene-6,11-dione?
The IUPAC name of indeno[2,1-b]chromene-6,11-dione (CID 10422105) is indeno[2,1-b]chromene-6,11-dione.
What is the SMILES notation for indeno[2,1-b]chromene-6,11-dione?
The canonical SMILES for indeno[2,1-b]chromene-6,11-dione is O=C1c2ccccc2-c2c1oc1ccccc1c2=O.
What is the InChIKey of indeno[2,1-b]chromene-6,11-dione?
The InChIKey is CXXCRLLJRGEAJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8O3/c17-14-11-7-3-4-8-12(11)19-16-13(14)9-5-1-2-6-10(9)15(16)18/h1-8H.
What are the key properties of indeno[2,1-b]chromene-6,11-dione?
indeno[2,1-b]chromene-6,11-dione has a molecular weight of 248.24 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for indeno[2,1-b]chromene-6,11-dione is sourced from PubChem (CID 10422105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).