About 6-iodo-N,N-dimethylpyridazin-3-amine
6-iodo-N,N-dimethylpyridazin-3-amine (PubChem CID 10422153) has the molecular formula C6H8IN3
and a molecular weight of 249.06 g/mol. Its IUPAC name is 6-iodo-N,N-dimethylpyridazin-3-amine.
Molecular Properties
| Compound Name | 6-iodo-N,N-dimethylpyridazin-3-amine |
| PubChem CID | 10422153 |
| Molecular Formula | C6H8IN3 |
| Molecular Weight | 249.06 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 6-iodo-N,N-dimethylpyridazin-3-amine |
| SMILES | CN(C)c1ccc(I)nn1 |
| InChI | InChI=1S/C6H8IN3/c1-10(2)6-4-3-5(7)8-9-6/h3-4H,1-2H3 |
| InChIKey | CNJMBLXXACEVSU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.06 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-N,N-dimethylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-N,N-dimethylpyridazin-3-amine?
The IUPAC name of 6-iodo-N,N-dimethylpyridazin-3-amine (CID 10422153) is 6-iodo-N,N-dimethylpyridazin-3-amine.
What is the SMILES notation for 6-iodo-N,N-dimethylpyridazin-3-amine?
The canonical SMILES for 6-iodo-N,N-dimethylpyridazin-3-amine is CN(C)c1ccc(I)nn1.
What is the InChIKey of 6-iodo-N,N-dimethylpyridazin-3-amine?
The InChIKey is CNJMBLXXACEVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8IN3/c1-10(2)6-4-3-5(7)8-9-6/h3-4H,1-2H3.
What are the key properties of 6-iodo-N,N-dimethylpyridazin-3-amine?
6-iodo-N,N-dimethylpyridazin-3-amine has a molecular weight of 249.06 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-N,N-dimethylpyridazin-3-amine is sourced from PubChem (CID 10422153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).