About (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid
(4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid (PubChem CID 10422251) has the molecular formula C7H7BrO5
and a molecular weight of 251.03 g/mol. Its IUPAC name is (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid.
Molecular Properties
| Compound Name | (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid |
| PubChem CID | 10422251 |
| Molecular Formula | C7H7BrO5 |
| Molecular Weight | 251.03 g/mol |
| Exact Mass | 249.95 |
| IUPAC Name | (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid |
| SMILES | O=C(O)C1=C(Br)C(=O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C7H7BrO5/c8-4-2(7(12)13)1-3(9)5(10)6(4)11/h3,5,9-10H,1H2,(H,12,13)/t3-,5+/m1/s1 |
| InChIKey | SZFVEAGZDIZWAT-WUJLRWPWSA-N |
| XLogP | -0.59 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.03 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid?
The IUPAC name of (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid (CID 10422251) is (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid.
What is the SMILES notation for (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid?
The canonical SMILES for (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid is O=C(O)C1=C(Br)C(=O)[C@@H](O)[C@H](O)C1.
What is the InChIKey of (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid?
The InChIKey is SZFVEAGZDIZWAT-WUJLRWPWSA-N. The full InChI is InChI=1S/C7H7BrO5/c8-4-2(7(12)13)1-3(9)5(10)6(4)11/h3,5,9-10H,1H2,(H,12,13)/t3-,5+/m1/s1.
What are the key properties of (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid?
(4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid has a molecular weight of 251.03 g/mol, XLogP of -0.59, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylic acid is sourced from PubChem (CID 10422251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).