About 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione
5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione (PubChem CID 10422753) has the molecular formula C17H11NO2
and a molecular weight of 261.28 g/mol. Its IUPAC name is 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione.
Molecular Properties
| Compound Name | 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione |
| PubChem CID | 10422753 |
| Molecular Formula | C17H11NO2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione |
| SMILES | O=C1C=CC(=O)c2nc3c(cc21)CCc1ccccc1-3 |
| InChI | InChI=1S/C17H11NO2/c19-14-7-8-15(20)17-13(14)9-11-6-5-10-3-1-2-4-12(10)16(11)18-17/h1-4,7-9H,5-6H2 |
| InChIKey | JIOCAQTWGNLFHH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione?
The IUPAC name of 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione (CID 10422753) is 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione.
What is the SMILES notation for 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione?
The canonical SMILES for 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione is O=C1C=CC(=O)c2nc3c(cc21)CCc1ccccc1-3.
What is the InChIKey of 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione?
The InChIKey is JIOCAQTWGNLFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO2/c19-14-7-8-15(20)17-13(14)9-11-6-5-10-3-1-2-4-12(10)16(11)18-17/h1-4,7-9H,5-6H2.
What are the key properties of 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione?
5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione has a molecular weight of 261.28 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydronaphtho[1,2-b]quinoline-8,11-dione is sourced from PubChem (CID 10422753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).