C6H3F9O — CID 10422795
3,3,4,4,5,5,6,6,6-nonafluorohexanal (PubChem CID 10422795) has the molecular formula C6H3F9O and a molecular weight of 262.07 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexanal.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexanal |
|---|---|
| PubChem CID | 10422795 |
| Molecular Formula | C6H3F9O |
| Molecular Weight | 262.07 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexanal |
| SMILES | O=CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3F9O/c7-3(8,1-2-16)4(9,10)5(11,12)6(13,14)15/h2H,1H2 |
| InChIKey | PLXBWBKXCKSJRL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.07 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|