C14H11ClN2O — CID 10422887
N-[(E)-benzylideneamino]-N-(2,3,4,5,6-pentadeuteriophenyl)carbamoyl chloride (PubChem CID 10422887) has the molecular formula C14H11ClN2O and a molecular weight of 263.74 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-N-(2,3,4,5,6-pentadeuteriophenyl)carbamoyl chloride.
| Compound Name | N-[(E)-benzylideneamino]-N-(2,3,4,5,6-pentadeuteriophenyl)carbamoyl chloride |
|---|---|
| PubChem CID | 10422887 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 263.74 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-[(E)-benzylideneamino]-N-(2,3,4,5,6-pentadeuteriophenyl)carbamoyl chloride |
| SMILES | [2H]c1c([2H])c([2H])c(N(/N=C/c2ccccc2)C(=O)Cl)c([2H])c1[2H] |
| InChI | InChI=1S/C14H11ClN2O/c15-14(18)17(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-11H/b16-11+/i2D,5D,6D,9D,10D |
| InChIKey | KCNJJUNLSVGLQZ-VGPDXIGXSA-N |
| XLogP | 3.89 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|