About 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide
2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide (PubChem CID 10423087) has the molecular formula C15H13N3O2
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1H-benzimidazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide |
| PubChem CID | 10423087 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(4-methoxyphenyl)-1H-benzimidazole-4-carboxamide |
| SMILES | COC1=CC=C(C=C1)C2=NC3=C(C=CC=C3N2)C(=O)N |
| InChI | InChI=1S/C15H13N3O2/c1-20-10-7-5-9(6-8-10)15-17-12-4-2-3-11(14(16)19)13(12)18-15/h2-8H,1H3,(H2,16,19)(H,17,18) |
| InChIKey | MKRGNKRNZLHINT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | 355 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide?
The IUPAC name of 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide (CID 10423087) is 2-(4-methoxyphenyl)-1H-benzimidazole-4-carboxamide.
What is the SMILES notation for 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide?
The canonical SMILES for 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide is COC1=CC=C(C=C1)C2=NC3=C(C=CC=C3N2)C(=O)N.
What is the InChIKey of 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide?
The InChIKey is MKRGNKRNZLHINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2/c1-20-10-7-5-9(6-8-10)15-17-12-4-2-3-11(14(16)19)13(12)18-15/h2-8H,1H3,(H2,16,19)(H,17,18).
What are the key properties of 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide?
2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide has a molecular weight of 267.28 g/mol, XLogP of 2.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-1H-1,3-benzodiazole-4-carboxamide is sourced from PubChem (CID 10423087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).