C16H17N3O — CID 10423102
2-(2-butoxyphenyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 10423102) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(2-butoxyphenyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(2-butoxyphenyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 10423102 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(2-butoxyphenyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | CCCCOc1ccccc1-c1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C16H17N3O/c1-2-3-11-20-14-9-5-4-7-12(14)15-18-13-8-6-10-17-16(13)19-15/h4-10H,2-3,11H2,1H3,(H,17,18,19) |
| InChIKey | KRERIEJRCQLQLV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|