About 7-iodo-6-methyl-1,5-dioxocan-2-one
7-iodo-6-methyl-1,5-dioxocan-2-one (PubChem CID 10423226) has the molecular formula C7H11IO3
and a molecular weight of 270.07 g/mol. Its IUPAC name is 7-iodo-6-methyl-1,5-dioxocan-2-one.
Molecular Properties
| Compound Name | 7-iodo-6-methyl-1,5-dioxocan-2-one |
| PubChem CID | 10423226 |
| Molecular Formula | C7H11IO3 |
| Molecular Weight | 270.07 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 7-iodo-6-methyl-1,5-dioxocan-2-one |
| SMILES | CC1OCCC(=O)OCC1I |
| InChI | InChI=1S/C7H11IO3/c1-5-6(8)4-11-7(9)2-3-10-5/h5-6H,2-4H2,1H3 |
| InChIKey | VIMFZOJHGXFWOR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.07 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-6-methyl-1,5-dioxocan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-6-methyl-1,5-dioxocan-2-one?
The IUPAC name of 7-iodo-6-methyl-1,5-dioxocan-2-one (CID 10423226) is 7-iodo-6-methyl-1,5-dioxocan-2-one.
What is the SMILES notation for 7-iodo-6-methyl-1,5-dioxocan-2-one?
The canonical SMILES for 7-iodo-6-methyl-1,5-dioxocan-2-one is CC1OCCC(=O)OCC1I.
What is the InChIKey of 7-iodo-6-methyl-1,5-dioxocan-2-one?
The InChIKey is VIMFZOJHGXFWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11IO3/c1-5-6(8)4-11-7(9)2-3-10-5/h5-6H,2-4H2,1H3.
What are the key properties of 7-iodo-6-methyl-1,5-dioxocan-2-one?
7-iodo-6-methyl-1,5-dioxocan-2-one has a molecular weight of 270.07 g/mol, XLogP of 1.14, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-6-methyl-1,5-dioxocan-2-one is sourced from PubChem (CID 10423226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).