About 1-benzyl-4-octyltriazole
1-benzyl-4-octyltriazole (PubChem CID 10423341) has the molecular formula C17H25N3
and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-benzyl-4-octyltriazole.
Molecular Properties
| Compound Name | 1-benzyl-4-octyltriazole |
| PubChem CID | 10423341 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-benzyl-4-octyltriazole |
| SMILES | CCCCCCCCc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C17H25N3/c1-2-3-4-5-6-10-13-17-15-20(19-18-17)14-16-11-8-7-9-12-16/h7-9,11-12,15H,2-6,10,13-14H2,1H3 |
| InChIKey | VSBVRLUYVFEDJE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-octyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-octyltriazole?
The IUPAC name of 1-benzyl-4-octyltriazole (CID 10423341) is 1-benzyl-4-octyltriazole.
What is the SMILES notation for 1-benzyl-4-octyltriazole?
The canonical SMILES for 1-benzyl-4-octyltriazole is CCCCCCCCc1cn(Cc2ccccc2)nn1.
What is the InChIKey of 1-benzyl-4-octyltriazole?
The InChIKey is VSBVRLUYVFEDJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3/c1-2-3-4-5-6-10-13-17-15-20(19-18-17)14-16-11-8-7-9-12-16/h7-9,11-12,15H,2-6,10,13-14H2,1H3.
What are the key properties of 1-benzyl-4-octyltriazole?
1-benzyl-4-octyltriazole has a molecular weight of 271.41 g/mol, XLogP of 4.23, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-octyltriazole is sourced from PubChem (CID 10423341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).