C12H19NO6 — CID 10423418
tert-butyl N-[(1R)-1-[(4R,5S)-5-ethenyl-2-oxo-1,3-dioxolan-4-yl]-2-hydroxyethyl]carbamate (PubChem CID 10423418) has the molecular formula C12H19NO6 and a molecular weight of 273.29 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[(4R,5S)-5-ethenyl-2-oxo-1,3-dioxolan-4-yl]-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[(4R,5S)-5-ethenyl-2-oxo-1,3-dioxolan-4-yl]-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 10423418 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | tert-butyl N-[(1R)-1-[(4R,5S)-5-ethenyl-2-oxo-1,3-dioxolan-4-yl]-2-hydroxyethyl]carbamate |
| SMILES | C=C[C@@H]1OC(=O)O[C@@H]1[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H19NO6/c1-5-8-9(18-11(16)17-8)7(6-14)13-10(15)19-12(2,3)4/h5,7-9,14H,1,6H2,2-4H3,(H,13,15)/t7-,8+,9-/m1/s1 |
| InChIKey | GARTVMKBVDGPMG-HRDYMLBCSA-N |
| XLogP | 0.96 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|