C18H32N2 — CID 10423605
N,N-dimethyl-N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]methanimidamide (PubChem CID 10423605) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]methanimidamide |
|---|---|
| PubChem CID | 10423605 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N,N-dimethyl-N'-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]methanimidamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C/N=C/N(C)C |
| InChI | InChI=1S/C18H32N2/c1-16(2)9-7-10-17(3)11-8-12-18(4)13-14-19-15-20(5)6/h9,11,13,15H,7-8,10,12,14H2,1-6H3/b17-11+,18-13+,19-15+ |
| InChIKey | FDMIBNLBTDFDLO-OZFNKYQOSA-N |
| XLogP | 5.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|