C17H26O3 — CID 10423696
heptadec-1-en-11,13-diyne-8,9,10-triol (PubChem CID 10423696) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is heptadec-1-en-11,13-diyne-8,9,10-triol.
| Compound Name | heptadec-1-en-11,13-diyne-8,9,10-triol |
|---|---|
| PubChem CID | 10423696 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | heptadec-1-en-11,13-diyne-8,9,10-triol |
| SMILES | C=CCCCCCC(O)C(O)C(O)C#CC#CCCC |
| InChI | InChI=1S/C17H26O3/c1-3-5-7-9-11-13-15(18)17(20)16(19)14-12-10-8-6-4-2/h3,15-20H,1,4-7,9,11,13H2,2H3 |
| InChIKey | VTJDJUWUGQEKRI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|