C14H17NO5 — CID 10423720
[methoxycarbonyl-[[(1S,2S)-2-phenylcyclopropyl]methyl]amino] methyl carbonate (PubChem CID 10423720) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is [methoxycarbonyl-[[(1S,2S)-2-phenylcyclopropyl]methyl]amino] methyl carbonate.
| Compound Name | [methoxycarbonyl-[[(1S,2S)-2-phenylcyclopropyl]methyl]amino] methyl carbonate |
|---|---|
| PubChem CID | 10423720 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | [methoxycarbonyl-[[(1S,2S)-2-phenylcyclopropyl]methyl]amino] methyl carbonate |
| SMILES | COC(=O)ON(C[C@H]1C[C@@H]1c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C14H17NO5/c1-18-13(16)15(20-14(17)19-2)9-11-8-12(11)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | FDKONSDJDXHPMR-VXGBXAGGSA-N |
| XLogP | 2.56 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|