C12H18N4O4 — CID 10423883
4-[2-(3,5-dioxopiperazin-1-yl)butyl]piperazine-2,6-dione (PubChem CID 10423883) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-[2-(3,5-dioxopiperazin-1-yl)butyl]piperazine-2,6-dione.
| Compound Name | 4-[2-(3,5-dioxopiperazin-1-yl)butyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 10423883 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4-[2-(3,5-dioxopiperazin-1-yl)butyl]piperazine-2,6-dione |
| SMILES | CCC(CN1CC(=O)NC(=O)C1)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C12H18N4O4/c1-2-8(16-6-11(19)14-12(20)7-16)3-15-4-9(17)13-10(18)5-15/h8H,2-7H2,1H3,(H,13,17,18)(H,14,19,20) |
| InChIKey | LYOGHIFIHCGJCM-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|