C14H18S3 — CID 10423929
12'-methylspiro[1,3-dithiolane-2,9'-2-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene] (PubChem CID 10423929) has the molecular formula C14H18S3 and a molecular weight of 282.50 g/mol. Its IUPAC name is 12'-methylspiro[1,3-dithiolane-2,9'-2-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene].
| Compound Name | 12'-methylspiro[1,3-dithiolane-2,9'-2-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene] |
|---|---|
| PubChem CID | 10423929 |
| Molecular Formula | C14H18S3 |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 12'-methylspiro[1,3-dithiolane-2,9'-2-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene] |
| SMILES | CC12C3=CSC1CCC1(SCCS1)C2=CCC3 |
| InChI | InChI=1S/C14H18S3/c1-13-10-3-2-4-11(13)14(16-7-8-17-14)6-5-12(13)15-9-10/h4,9,12H,2-3,5-8H2,1H3 |
| InChIKey | DUNRUEBIGCJZMM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|