About N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide
N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide (PubChem CID 10423965) has the molecular formula C12H13NO3S2
and a molecular weight of 283.37 g/mol. Its IUPAC name is N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide.
Molecular Properties
| Compound Name | N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide |
| PubChem CID | 10423965 |
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide |
| SMILES | CCONC(=O)C(O)(c1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C12H13NO3S2/c1-2-16-13-11(14)12(15,9-3-5-17-7-9)10-4-6-18-8-10/h3-8,15H,2H2,1H3,(H,13,14) |
| InChIKey | NSKSYRDHMGIIEN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide?
The IUPAC name of N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide (CID 10423965) is N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide.
What is the SMILES notation for N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide?
The canonical SMILES for N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide is CCONC(=O)C(O)(c1ccsc1)c1ccsc1.
What is the InChIKey of N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide?
The InChIKey is NSKSYRDHMGIIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3S2/c1-2-16-13-11(14)12(15,9-3-5-17-7-9)10-4-6-18-8-10/h3-8,15H,2H2,1H3,(H,13,14).
What are the key properties of N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide?
N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide has a molecular weight of 283.37 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-2-hydroxy-2,2-di(thiophen-3-yl)acetamide is sourced from PubChem (CID 10423965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).