C20H28O — CID 10424032
(1R,3S,3aS,6R,9aS)-3,6-dimethyl-9-methylidene-1-(2-methylprop-1-enyl)-3,3a,4,5,6,7,8,9a-octahydro-1H-phenalen-2-one (PubChem CID 10424032) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (1R,3S,3aS,6R,9aS)-3,6-dimethyl-9-methylidene-1-(2-methylprop-1-enyl)-3,3a,4,5,6,7,8,9a-octahydro-1H-phenalen-2-one.
| Compound Name | (1R,3S,3aS,6R,9aS)-3,6-dimethyl-9-methylidene-1-(2-methylprop-1-enyl)-3,3a,4,5,6,7,8,9a-octahydro-1H-phenalen-2-one |
|---|---|
| PubChem CID | 10424032 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (1R,3S,3aS,6R,9aS)-3,6-dimethyl-9-methylidene-1-(2-methylprop-1-enyl)-3,3a,4,5,6,7,8,9a-octahydro-1H-phenalen-2-one |
| SMILES | C=C1CCC2=C3[C@H]1[C@@H](C=C(C)C)C(=O)[C@@H](C)[C@@H]3CC[C@H]2C |
| InChI | InChI=1S/C20H28O/c1-11(2)10-17-18-13(4)7-8-15-12(3)6-9-16(19(15)18)14(5)20(17)21/h10,12,14,16-18H,4,6-9H2,1-3,5H3/t12-,14+,16+,17-,18-/m1/s1 |
| InChIKey | CLCADWBFWGLAJS-QGULPLLQSA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|