About 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile
2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile (PubChem CID 10424154) has the molecular formula C18H13N3O
and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile |
| PubChem CID | 10424154 |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(c1-c1ccco1)CCc1ccccc1-2 |
| InChI | InChI=1S/C18H13N3O/c19-10-14-16(15-6-3-9-22-15)13-8-7-11-4-1-2-5-12(11)17(13)21-18(14)20/h1-6,9H,7-8H2,(H2,20,21) |
| InChIKey | VHHWIZGIWRFSAA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile?
The IUPAC name of 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile (CID 10424154) is 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile.
What is the SMILES notation for 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile?
The canonical SMILES for 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile is N#Cc1c(N)nc2c(c1-c1ccco1)CCc1ccccc1-2.
What is the InChIKey of 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile?
The InChIKey is VHHWIZGIWRFSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O/c19-10-14-16(15-6-3-9-22-15)13-8-7-11-4-1-2-5-12(11)17(13)21-18(14)20/h1-6,9H,7-8H2,(H2,20,21).
What are the key properties of 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile?
2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile has a molecular weight of 287.32 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(furan-2-yl)-5,6-dihydrobenzo[h]quinoline-3-carbonitrile is sourced from PubChem (CID 10424154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).