C17H23NO3 — CID 10424268
[(1S,6R,8aS)-6-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate (PubChem CID 10424268) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is [(1S,6R,8aS)-6-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate.
| Compound Name | [(1S,6R,8aS)-6-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
|---|---|
| PubChem CID | 10424268 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [(1S,6R,8aS)-6-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCN2C[C@H](OCc3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C17H23NO3/c1-13(19)21-17-9-10-18-11-15(7-8-16(17)18)20-12-14-5-3-2-4-6-14/h2-6,15-17H,7-12H2,1H3/t15-,16+,17+/m1/s1 |
| InChIKey | CADLCESROFHLBE-IKGGRYGDSA-N |
| XLogP | 2.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |