About 1,3,4-trimethoxydibenzofuran-2,6-diol
1,3,4-trimethoxydibenzofuran-2,6-diol (PubChem CID 10424294) has the molecular formula C15H14O6
and a molecular weight of 290.27 g/mol. Its IUPAC name is 1,3,4-trimethoxydibenzofuran-2,6-diol.
Molecular Properties
| Compound Name | 1,3,4-trimethoxydibenzofuran-2,6-diol |
| PubChem CID | 10424294 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1,3,4-trimethoxydibenzofuran-2,6-diol |
| SMILES | COc1c(O)c(OC)c2c(oc3c(O)cccc32)c1OC |
| InChI | InChI=1S/C15H14O6/c1-18-12-9-7-5-4-6-8(16)11(7)21-13(9)15(20-3)14(19-2)10(12)17/h4-6,16-17H,1-3H3 |
| InChIKey | XUGBHEYCYSYJSM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3,4-trimethoxydibenzofuran-2,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-trimethoxydibenzofuran-2,6-diol?
The IUPAC name of 1,3,4-trimethoxydibenzofuran-2,6-diol (CID 10424294) is 1,3,4-trimethoxydibenzofuran-2,6-diol.
What is the SMILES notation for 1,3,4-trimethoxydibenzofuran-2,6-diol?
The canonical SMILES for 1,3,4-trimethoxydibenzofuran-2,6-diol is COc1c(O)c(OC)c2c(oc3c(O)cccc32)c1OC.
What is the InChIKey of 1,3,4-trimethoxydibenzofuran-2,6-diol?
The InChIKey is XUGBHEYCYSYJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O6/c1-18-12-9-7-5-4-6-8(16)11(7)21-13(9)15(20-3)14(19-2)10(12)17/h4-6,16-17H,1-3H3.
What are the key properties of 1,3,4-trimethoxydibenzofuran-2,6-diol?
1,3,4-trimethoxydibenzofuran-2,6-diol has a molecular weight of 290.27 g/mol, XLogP of 3.02, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-trimethoxydibenzofuran-2,6-diol is sourced from PubChem (CID 10424294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).