C15H18BrN — CID 10424408
(3aR,9bS)-9-bromo-3-prop-2-enyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole (PubChem CID 10424408) has the molecular formula C15H18BrN and a molecular weight of 292.22 g/mol. Its IUPAC name is (3aR,9bS)-9-bromo-3-prop-2-enyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole.
| Compound Name | (3aR,9bS)-9-bromo-3-prop-2-enyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 10424408 |
| Molecular Formula | C15H18BrN |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | (3aR,9bS)-9-bromo-3-prop-2-enyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
| SMILES | C=CCN1CC[C@H]2c3c(Br)cccc3CC[C@H]21 |
| InChI | InChI=1S/C15H18BrN/c1-2-9-17-10-8-12-14(17)7-6-11-4-3-5-13(16)15(11)12/h2-5,12,14H,1,6-10H2/t12-,14-/m1/s1 |
| InChIKey | ACZSQSNJZPULJH-TZMCWYRMSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|