C17H24O4 — CID 10424435
(1R,6S)-10,11-bis(methoxymethoxymethyl)tricyclo[4.3.2.01,6]undeca-2,4,10-triene (PubChem CID 10424435) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1R,6S)-10,11-bis(methoxymethoxymethyl)tricyclo[4.3.2.01,6]undeca-2,4,10-triene.
| Compound Name | (1R,6S)-10,11-bis(methoxymethoxymethyl)tricyclo[4.3.2.01,6]undeca-2,4,10-triene |
|---|---|
| PubChem CID | 10424435 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R,6S)-10,11-bis(methoxymethoxymethyl)tricyclo[4.3.2.01,6]undeca-2,4,10-triene |
| SMILES | COCOCC1=C(COCOC)[C@]23C=CC=C[C@]12CCC3 |
| InChI | InChI=1S/C17H24O4/c1-18-12-20-10-14-15(11-21-13-19-2)17-7-4-3-6-16(14,17)8-5-9-17/h3-4,6-7H,5,8-13H2,1-2H3/t16-,17+ |
| InChIKey | PYCGMBFGDOHGBT-CALCHBBNSA-N |
| XLogP | 2.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|