C20H39N — CID 10424485
N,N-bis(prop-2-enyl)tetradecan-1-amine (PubChem CID 10424485) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)tetradecan-1-amine.
| Compound Name | N,N-bis(prop-2-enyl)tetradecan-1-amine |
|---|---|
| PubChem CID | 10424485 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | N,N-bis(prop-2-enyl)tetradecan-1-amine |
| SMILES | C=CCN(CC=C)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C20H39N/c1-4-7-8-9-10-11-12-13-14-15-16-17-20-21(18-5-2)19-6-3/h5-6H,2-4,7-20H2,1H3 |
| InChIKey | HNRPWNCIFZSWPG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|