About [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate
[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate (PubChem CID 10424544) has the molecular formula C18H30O3
and a molecular weight of 294.44 g/mol. Its IUPAC name is [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate.
Molecular Properties
| Compound Name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate |
| PubChem CID | 10424544 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate |
| SMILES | C=CCCCC(=O)CC(=O)O[C@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C18H30O3/c1-5-6-7-8-15(19)12-18(20)21-17-11-14(4)9-10-16(17)13(2)3/h5,13-14,16-17H,1,6-12H2,2-4H3/t14-,16+,17+/m1/s1 |
| InChIKey | GELDFKPTCQEBTC-PVAVHDDUSA-N |
| XLogP | 4.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate?
The IUPAC name of [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate (CID 10424544) is [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate.
What is the SMILES notation for [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate?
The canonical SMILES for [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate is C=CCCCC(=O)CC(=O)O[C@H]1C[C@H](C)CC[C@H]1C(C)C.
What is the InChIKey of [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate?
The InChIKey is GELDFKPTCQEBTC-PVAVHDDUSA-N. The full InChI is InChI=1S/C18H30O3/c1-5-6-7-8-15(19)12-18(20)21-17-11-14(4)9-10-16(17)13(2)3/h5,13-14,16-17H,1,6-12H2,2-4H3/t14-,16+,17+/m1/s1.
What are the key properties of [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate?
[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate has a molecular weight of 294.44 g/mol, XLogP of 4.31, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-oxooct-7-enoate is sourced from PubChem (CID 10424544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).