C19H27FN2 — CID 10425027
4-fluoro-3-methyl-N,N-dipropyl-6,7,8,9-tetrahydrobenzo[e]indol-8-amine (PubChem CID 10425027) has the molecular formula C19H27FN2 and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N,N-dipropyl-6,7,8,9-tetrahydrobenzo[e]indol-8-amine.
| Compound Name | 4-fluoro-3-methyl-N,N-dipropyl-6,7,8,9-tetrahydrobenzo[e]indol-8-amine |
|---|---|
| PubChem CID | 10425027 |
| Molecular Formula | C19H27FN2 |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 4-fluoro-3-methyl-N,N-dipropyl-6,7,8,9-tetrahydrobenzo[e]indol-8-amine |
| SMILES | CCCN(CCC)C1CCc2cc(F)c3c(ccn3C)c2C1 |
| InChI | InChI=1S/C19H27FN2/c1-4-9-22(10-5-2)15-7-6-14-12-18(20)19-16(17(14)13-15)8-11-21(19)3/h8,11-12,15H,4-7,9-10,13H2,1-3H3 |
| InChIKey | VAATVGITWGBTOR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|